About 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione
5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione (PubChem CID 142602224) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione.
Molecular Properties
| Compound Name | 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione |
| PubChem CID | 142602224 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione |
| SMILES | [H]/N=C1\NC(=O)CCCCCCOC(=O)CN1C |
| InChI | InChI=1S/C11H19N3O3/c1-14-8-10(16)17-7-5-3-2-4-6-9(15)13-11(14)12/h2-8H2,1H3,(H2,12,13,15) |
| InChIKey | USWSINOMNAEAKE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione?
The IUPAC name of 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione (CID 142602224) is 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione.
What is the SMILES notation for 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione?
The canonical SMILES for 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione is [H]/N=C1\NC(=O)CCCCCCOC(=O)CN1C.
What is the InChIKey of 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione?
The InChIKey is USWSINOMNAEAKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3/c1-14-8-10(16)17-7-5-3-2-4-6-9(15)13-11(14)12/h2-8H2,1H3,(H2,12,13,15).
What are the key properties of 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione?
5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione has a molecular weight of 241.29 g/mol, XLogP of 0.48, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione is sourced from PubChem (CID 142602224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).