C11H19N3O3 — CID 142602224
5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione (PubChem CID 142602224) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione.
| Compound Name | 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione |
|---|---|
| PubChem CID | 142602224 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 5-imino-4-methyl-1-oxa-4,6-diazacyclotridecane-2,7-dione |
| SMILES | [H]/N=C1\NC(=O)CCCCCCOC(=O)CN1C |
| InChI | InChI=1S/C11H19N3O3/c1-14-8-10(16)17-7-5-3-2-4-6-9(15)13-11(14)12/h2-8H2,1H3,(H2,12,13,15) |
| InChIKey | USWSINOMNAEAKE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|