About 1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole
1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole (PubChem CID 102582139) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole.
Analyze 1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole?
The IUPAC name of 1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole (CID 102582139) is 1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole.
What is the SMILES notation for 1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole?
The canonical SMILES for 1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole is CN1CN(C)C2=C1N(C)CN2C.
What is the InChIKey of 1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole?
The InChIKey is IGNKCCSSEXYXIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-9-5-10(2)8-7(9)11(3)6-12(8)4/h5-6H2,1-4H3.
What are the key properties of 1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole?
1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole has a molecular weight of 168.24 g/mol, XLogP of -0.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4,6-tetramethyl-2,5-dihydroimidazo[4,5-d]imidazole is sourced from PubChem (CID 102582139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).