About (1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum
(1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum (PubChem CID 87351770) has the molecular formula C4H9N3Pt
and a molecular weight of 294.22 g/mol. Its IUPAC name is (1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum.
Analyze (1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum?
The IUPAC name of (1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum (CID 87351770) is (1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum.
What is the SMILES notation for (1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum?
The canonical SMILES for (1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum is CN1CN(C)C(=[Pt])N1.
What is the InChIKey of (1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum?
The InChIKey is BSMOKGATQDNBMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3.Pt/c1-6-3-5-7(2)4-6;/h5H,4H2,1-2H3;.
What are the key properties of (1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum?
(1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum has a molecular weight of 294.22 g/mol, XLogP of -1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dimethyl-1,2,4-triazolidin-3-ylidene)platinum is sourced from PubChem (CID 87351770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).