C5H8Cl2N2 — CID 21304542
4,5-dichloro-1,3-dimethyl-2H-imidazole (PubChem CID 21304542) has the molecular formula C5H8Cl2N2 and a molecular weight of 167.04 g/mol. Its IUPAC name is 4,5-dichloro-1,3-dimethyl-2H-imidazole.
| Compound Name | 4,5-dichloro-1,3-dimethyl-2H-imidazole |
|---|---|
| PubChem CID | 21304542 |
| Molecular Formula | C5H8Cl2N2 |
| Molecular Weight | 167.04 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 4,5-dichloro-1,3-dimethyl-2H-imidazole |
| SMILES | CN1CN(C)C(Cl)=C1Cl |
| InChI | InChI=1S/C5H8Cl2N2/c1-8-3-9(2)5(7)4(8)6/h3H2,1-2H3 |
| InChIKey | KMOCCRPFSUXKJA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.04 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|