C7H12N2O — CID 163795502
2,4-dimethyl-1,2,5,6-tetrahydropyrrolo[3,2-d][1,3]oxazole (PubChem CID 163795502) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 2,4-dimethyl-1,2,5,6-tetrahydropyrrolo[3,2-d][1,3]oxazole.
| Compound Name | 2,4-dimethyl-1,2,5,6-tetrahydropyrrolo[3,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 163795502 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2,4-dimethyl-1,2,5,6-tetrahydropyrrolo[3,2-d][1,3]oxazole |
| SMILES | CC1NC2=C(O1)N(C)CC2 |
| InChI | InChI=1S/C7H12N2O/c1-5-8-6-3-4-9(2)7(6)10-5/h5,8H,3-4H2,1-2H3 |
| InChIKey | NAKKGZDPXGUQFL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |