C7H13N5O+2 — CID 170842929
(7,9-dimethyl-6-oxo-3,8-dihydropurin-3-ium-2-ylidene)azanium (PubChem CID 170842929) has the molecular formula C7H13N5O+2 and a molecular weight of 183.21 g/mol. Its IUPAC name is (7,9-dimethyl-6-oxo-3,8-dihydropurin-3-ium-2-ylidene)azanium.
| Compound Name | (7,9-dimethyl-6-oxo-3,8-dihydropurin-3-ium-2-ylidene)azanium |
|---|---|
| PubChem CID | 170842929 |
| Molecular Formula | C7H13N5O+2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (7,9-dimethyl-6-oxo-3,8-dihydropurin-3-ium-2-ylidene)azanium |
| SMILES | CN1CN(C)C2=C1[NH2+]C(=[NH2+])NC2=O |
| InChI | InChI=1S/C7H11N5O/c1-11-3-12(2)5-4(11)6(13)10-7(8)9-5/h3H2,1-2H3,(H3,8,9,10,13)/p+2 |
| InChIKey | KKQKBURHSNOSCZ-UHFFFAOYSA-P |
| XLogP | -4.20 |
| TPSA | 77.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|