C7H11IN4O — CID 71360270
7,9-dimethyl-1,8-dihydropurin-1-ium-6-one iodide (PubChem CID 71360270) has the molecular formula C7H11IN4O and a molecular weight of 294.10 g/mol. Its IUPAC name is 7,9-dimethyl-1,8-dihydropurin-1-ium-6-one iodide.
| Compound Name | 7,9-dimethyl-1,8-dihydropurin-1-ium-6-one iodide |
|---|---|
| PubChem CID | 71360270 |
| Molecular Formula | C7H11IN4O |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 7,9-dimethyl-1,8-dihydropurin-1-ium-6-one iodide |
| SMILES | CN1CN(C)C2=C1N=C[NH2+]C2=O.[I-] |
| InChI | InChI=1S/C7H10N4O.HI/c1-10-4-11(2)6-5(10)7(12)9-3-8-6;/h3H,4H2,1-2H3,(H,8,9,12);1H |
| InChIKey | BEAPQPIEXJFPQR-UHFFFAOYSA-N |
| XLogP | -4.87 |
| TPSA | 52.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|