C8H13N3O2 — CID 82407230
3-amino-1-methyl-3,3a,4,7a-tetrahydro-2H-pyrrolo[2,3-c]pyridine-5,7-dione (PubChem CID 82407230) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-amino-1-methyl-3,3a,4,7a-tetrahydro-2H-pyrrolo[2,3-c]pyridine-5,7-dione.
| Compound Name | 3-amino-1-methyl-3,3a,4,7a-tetrahydro-2H-pyrrolo[2,3-c]pyridine-5,7-dione |
|---|---|
| PubChem CID | 82407230 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 3-amino-1-methyl-3,3a,4,7a-tetrahydro-2H-pyrrolo[2,3-c]pyridine-5,7-dione |
| SMILES | CN1CC(N)C2CC(=O)NC(=O)C21 |
| InChI | InChI=1S/C8H13N3O2/c1-11-3-5(9)4-2-6(12)10-8(13)7(4)11/h4-5,7H,2-3,9H2,1H3,(H,10,12,13) |
| InChIKey | SBMFQFGGDATZMU-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|