C7H13N5O+2 — CID 135856425
2-amino-7,9-dimethyl-1,8-dihydropurine-1,3-diium-6-one (PubChem CID 135856425) has the molecular formula C7H13N5O+2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-amino-7,9-dimethyl-1,8-dihydropurine-1,3-diium-6-one.
| Compound Name | 2-amino-7,9-dimethyl-1,8-dihydropurine-1,3-diium-6-one |
|---|---|
| PubChem CID | 135856425 |
| Molecular Formula | C7H13N5O+2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-amino-7,9-dimethyl-1,8-dihydropurine-1,3-diium-6-one |
| SMILES | CN1CN(C)C2=C1[NH+]=C(N)[NH2+]C2=O |
| InChI | InChI=1S/C7H11N5O/c1-11-3-12(2)5-4(11)6(13)10-7(8)9-5/h3H2,1-2H3,(H3,8,9,10,13)/p+2 |
| InChIKey | KKQKBURHSNOSCZ-UHFFFAOYSA-P |
| XLogP | -4.51 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |