C18H26N2 — CID 156674418
4-(4,4-dimethylcyclohexyl)-1-methyl-3-phenyl-2H-imidazole (PubChem CID 156674418) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-(4,4-dimethylcyclohexyl)-1-methyl-3-phenyl-2H-imidazole.
| Compound Name | 4-(4,4-dimethylcyclohexyl)-1-methyl-3-phenyl-2H-imidazole |
|---|---|
| PubChem CID | 156674418 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 4-(4,4-dimethylcyclohexyl)-1-methyl-3-phenyl-2H-imidazole |
| SMILES | CN1C=C(C2CCC(C)(C)CC2)N(c2ccccc2)C1 |
| InChI | InChI=1S/C18H26N2/c1-18(2)11-9-15(10-12-18)17-13-19(3)14-20(17)16-7-5-4-6-8-16/h4-8,13,15H,9-12,14H2,1-3H3 |
| InChIKey | OJAUUAWLYLUIJT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |