C13H14N2O — CID 162540284
3-amino-2,3,6,7-tetrahydrobenzo[a]quinolizin-4-one (PubChem CID 162540284) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-amino-2,3,6,7-tetrahydrobenzo[a]quinolizin-4-one.
| Compound Name | 3-amino-2,3,6,7-tetrahydrobenzo[a]quinolizin-4-one |
|---|---|
| PubChem CID | 162540284 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3-amino-2,3,6,7-tetrahydrobenzo[a]quinolizin-4-one |
| SMILES | NC1CC=C2c3ccccc3CCN2C1=O |
| InChI | InChI=1S/C13H14N2O/c14-11-5-6-12-10-4-2-1-3-9(10)7-8-15(12)13(11)16/h1-4,6,11H,5,7-8,14H2 |
| InChIKey | MUSIOFJUUGAYBV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |