C17H16N4O — CID 21201461
6,11-diamino-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-12-one (PubChem CID 21201461) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 6,11-diamino-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-12-one.
| Compound Name | 6,11-diamino-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-12-one |
|---|---|
| PubChem CID | 21201461 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 6,11-diamino-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-12-one |
| SMILES | Nc1cc2c3c(c1)C(c1ccccc1)=NC(N)C(=O)N3CC2 |
| InChI | InChI=1S/C17H16N4O/c18-12-8-11-6-7-21-15(11)13(9-12)14(20-16(19)17(21)22)10-4-2-1-3-5-10/h1-5,8-9,16H,6-7,18-19H2 |
| InChIKey | HPXAUSKCFMFNEW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|