C22H24N6O2 — CID 10111845
N-(6-amino-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl)piperazine-2-carboxamide (PubChem CID 10111845) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-(6-amino-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl)piperazine-2-carboxamide.
| Compound Name | N-(6-amino-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 10111845 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-(6-amino-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl)piperazine-2-carboxamide |
| SMILES | Nc1cc2c3c(c1)C(c1ccccc1)=NC(NC(=O)C1CNCCN1)C(=O)N3CC2 |
| InChI | InChI=1S/C22H24N6O2/c23-15-10-14-6-9-28-19(14)16(11-15)18(13-4-2-1-3-5-13)26-20(22(28)30)27-21(29)17-12-24-7-8-25-17/h1-5,10-11,17,20,24-25H,6-9,12,23H2,(H,27,29) |
| InChIKey | MZIHNDYNTXCSJE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|