C10H13ClN2S — CID 162532392
(1S,8R)-3-(chloromethyl)-5-thia-2,7-diazatricyclo[6.3.1.02,6]dodeca-3,6-diene (PubChem CID 162532392) has the molecular formula C10H13ClN2S and a molecular weight of 228.75 g/mol. Its IUPAC name is (1S,8R)-3-(chloromethyl)-5-thia-2,7-diazatricyclo[6.3.1.02,6]dodeca-3,6-diene.
| Compound Name | (1S,8R)-3-(chloromethyl)-5-thia-2,7-diazatricyclo[6.3.1.02,6]dodeca-3,6-diene |
|---|---|
| PubChem CID | 162532392 |
| Molecular Formula | C10H13ClN2S |
| Molecular Weight | 228.75 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | (1S,8R)-3-(chloromethyl)-5-thia-2,7-diazatricyclo[6.3.1.02,6]dodeca-3,6-diene |
| SMILES | ClCC1=CSC2=N[C@@H]3CCC[C@@H](C3)N12 |
| InChI | InChI=1S/C10H13ClN2S/c11-5-9-6-14-10-12-7-2-1-3-8(4-7)13(9)10/h6-8H,1-5H2/t7-,8+/m1/s1 |
| InChIKey | ZGYZROWEPDORIZ-SFYZADRCSA-N |
| XLogP | 2.80 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|