C8H9ClN2OS — CID 155177075
(6S)-11-(chloromethyl)-4-oxa-9-thia-1,7-diazatricyclo[6.3.0.02,6]undeca-7,10-diene (PubChem CID 155177075) has the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. Its IUPAC name is (6S)-11-(chloromethyl)-4-oxa-9-thia-1,7-diazatricyclo[6.3.0.02,6]undeca-7,10-diene.
| Compound Name | (6S)-11-(chloromethyl)-4-oxa-9-thia-1,7-diazatricyclo[6.3.0.02,6]undeca-7,10-diene |
|---|---|
| PubChem CID | 155177075 |
| Molecular Formula | C8H9ClN2OS |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | (6S)-11-(chloromethyl)-4-oxa-9-thia-1,7-diazatricyclo[6.3.0.02,6]undeca-7,10-diene |
| SMILES | ClCC1=CSC2=N[C@@H]3COCC3N12 |
| InChI | InChI=1S/C8H9ClN2OS/c9-1-5-4-13-8-10-6-2-12-3-7(6)11(5)8/h4,6-7H,1-3H2/t6-,7?/m1/s1 |
| InChIKey | ZBRBIUMQOAUPRJ-ULUSZKPHSA-N |
| XLogP | 1.25 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|