C12H11Cl3N2S — CID 169004875
3-(chloromethyl)-6-(4-chlorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride (PubChem CID 169004875) has the molecular formula C12H11Cl3N2S and a molecular weight of 321.66 g/mol. Its IUPAC name is 3-(chloromethyl)-6-(4-chlorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride.
| Compound Name | 3-(chloromethyl)-6-(4-chlorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride |
|---|---|
| PubChem CID | 169004875 |
| Molecular Formula | C12H11Cl3N2S |
| Molecular Weight | 321.66 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 3-(chloromethyl)-6-(4-chlorophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride |
| SMILES | Cl.ClCC1=CSC2=NC(c3ccc(Cl)cc3)CN12 |
| InChI | InChI=1S/C12H10Cl2N2S.ClH/c13-5-10-7-17-12-15-11(6-16(10)12)8-1-3-9(14)4-2-8;/h1-4,7,11H,5-6H2;1H |
| InChIKey | YIOGFUSCUURTFE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.66 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|