C12H20Cl2N2S — CID 155166937
3-(chloromethyl)-5,6-di(propan-2-yl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride (PubChem CID 155166937) has the molecular formula C12H20Cl2N2S and a molecular weight of 295.28 g/mol. Its IUPAC name is 3-(chloromethyl)-5,6-di(propan-2-yl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride.
| Compound Name | 3-(chloromethyl)-5,6-di(propan-2-yl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride |
|---|---|
| PubChem CID | 155166937 |
| Molecular Formula | C12H20Cl2N2S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-(chloromethyl)-5,6-di(propan-2-yl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride |
| SMILES | CC(C)C1N=C2SC=C(CCl)N2C1C(C)C.Cl |
| InChI | InChI=1S/C12H19ClN2S.ClH/c1-7(2)10-11(8(3)4)15-9(5-13)6-16-12(15)14-10;/h6-8,10-11H,5H2,1-4H3;1H |
| InChIKey | VJEUNXSAHFJCBA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|