C11H11ClN2S2 — CID 169005065
3-(chloromethyl)-6-(thiophen-2-ylmethyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 169005065) has the molecular formula C11H11ClN2S2 and a molecular weight of 270.81 g/mol. Its IUPAC name is 3-(chloromethyl)-6-(thiophen-2-ylmethyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 3-(chloromethyl)-6-(thiophen-2-ylmethyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 169005065 |
| Molecular Formula | C11H11ClN2S2 |
| Molecular Weight | 270.81 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 3-(chloromethyl)-6-(thiophen-2-ylmethyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | ClCC1=CSC2=NC(Cc3cccs3)CN12 |
| InChI | InChI=1S/C11H11ClN2S2/c12-5-9-7-16-11-13-8(6-14(9)11)4-10-2-1-3-15-10/h1-3,7-8H,4-6H2 |
| InChIKey | TUUXYCIXOXTJOY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|