About 2-(chloromethyl)thiophene;triphenylphosphane
2-(chloromethyl)thiophene;triphenylphosphane (PubChem CID 87275882) has the molecular formula C23H20ClPS
and a molecular weight of 394.91 g/mol. Its IUPAC name is 2-(chloromethyl)thiophene;triphenylphosphane.
Molecular Properties
| Compound Name | 2-(chloromethyl)thiophene;triphenylphosphane |
| PubChem CID | 87275882 |
| Molecular Formula | C23H20ClPS |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-(chloromethyl)thiophene;triphenylphosphane |
| SMILES | ClCc1cccs1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C5H5ClS/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6-4-5-2-1-3-7-5/h1-15H;1-3H,4H2 |
| InChIKey | NIQGHURUECNVIL-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)thiophene;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)thiophene;triphenylphosphane?
The IUPAC name of 2-(chloromethyl)thiophene;triphenylphosphane (CID 87275882) is 2-(chloromethyl)thiophene;triphenylphosphane.
What is the SMILES notation for 2-(chloromethyl)thiophene;triphenylphosphane?
The canonical SMILES for 2-(chloromethyl)thiophene;triphenylphosphane is ClCc1cccs1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-(chloromethyl)thiophene;triphenylphosphane?
The InChIKey is NIQGHURUECNVIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C5H5ClS/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6-4-5-2-1-3-7-5/h1-15H;1-3H,4H2.
What are the key properties of 2-(chloromethyl)thiophene;triphenylphosphane?
2-(chloromethyl)thiophene;triphenylphosphane has a molecular weight of 394.91 g/mol, XLogP of 5.93, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)thiophene;triphenylphosphane is sourced from PubChem (CID 87275882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).