C13H13ClN2S2 — CID 9420194
(4aS,8aR)-1-(5-chlorothiophen-2-yl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole (PubChem CID 9420194) has the molecular formula C13H13ClN2S2 and a molecular weight of 296.85 g/mol. Its IUPAC name is (4aS,8aR)-1-(5-chlorothiophen-2-yl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole.
| Compound Name | (4aS,8aR)-1-(5-chlorothiophen-2-yl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 9420194 |
| Molecular Formula | C13H13ClN2S2 |
| Molecular Weight | 296.85 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (4aS,8aR)-1-(5-chlorothiophen-2-yl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
| SMILES | Clc1ccc(C2=CSC3=N[C@H]4CCCC[C@H]4N23)s1 |
| InChI | InChI=1S/C13H13ClN2S2/c14-12-6-5-11(18-12)10-7-17-13-15-8-3-1-2-4-9(8)16(10)13/h5-9H,1-4H2/t8-,9+/m0/s1 |
| InChIKey | LDYKVDXGXDBMRY-DTWKUNHWSA-N |
| XLogP | 4.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.85 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |