C18H23N3O2S — CID 9420227
ethyl 5-[(4aS,8aS)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 9420227) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is ethyl 5-[(4aS,8aS)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[(4aS,8aS)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 9420227 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | ethyl 5-[(4aS,8aS)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C2=CSC3=N[C@H]4CCCC[C@@H]4N23)c1C |
| InChI | InChI=1S/C18H23N3O2S/c1-4-23-17(22)15-10(2)16(19-11(15)3)14-9-24-18-20-12-7-5-6-8-13(12)21(14)18/h9,12-13,19H,4-8H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | LHGPUWQAMMMQDB-STQMWFEESA-N |
| XLogP | 3.84 |
| TPSA | 57.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |