C19H27N3O4S — CID 51925888
diethyl 5-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 51925888) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is diethyl 5-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 51925888 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | diethyl 5-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(CSC2=N[C@@H]3CCCC[C@H]3N2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C19H27N3O4S/c1-4-25-17(23)15-11(3)16(18(24)26-5-2)20-14(15)10-27-19-21-12-8-6-7-9-13(12)22-19/h12-13,20H,4-10H2,1-3H3,(H,21,22)/t12-,13-/m1/s1 |
| InChIKey | RZNXRLUVIKAMLU-CHWSQXEVSA-N |
| XLogP | 3.18 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |