C18H19N3OS — CID 9420588
6-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 9420588) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 6-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 9420588 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 6-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C3=CSC4=N[C@@H]5CCCC[C@H]5N34)ccc2N1 |
| InChI | InChI=1S/C18H19N3OS/c22-17-8-6-11-9-12(5-7-13(11)19-17)16-10-23-18-20-14-3-1-2-4-15(14)21(16)18/h5,7,9-10,14-15H,1-4,6,8H2,(H,19,22)/t14-,15-/m1/s1 |
| InChIKey | XORBJLGUXKONOK-HUUCEWRRSA-N |
| XLogP | 3.60 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |