About 4-formyl-2,6-dimethylbenzoic acid
4-formyl-2,6-dimethylbenzoic acid (PubChem CID 20619423) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-formyl-2,6-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 4-formyl-2,6-dimethylbenzoic acid |
| PubChem CID | 20619423 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4-formyl-2,6-dimethylbenzoic acid |
| SMILES | Cc1cc(C=O)cc(C)c1C(=O)O |
| InChI | InChI=1S/C10H10O3/c1-6-3-8(5-11)4-7(2)9(6)10(12)13/h3-5H,1-2H3,(H,12,13) |
| InChIKey | IZLUAIAAIWYAHL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-formyl-2,6-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formyl-2,6-dimethylbenzoic acid?
The IUPAC name of 4-formyl-2,6-dimethylbenzoic acid (CID 20619423) is 4-formyl-2,6-dimethylbenzoic acid.
What is the SMILES notation for 4-formyl-2,6-dimethylbenzoic acid?
The canonical SMILES for 4-formyl-2,6-dimethylbenzoic acid is Cc1cc(C=O)cc(C)c1C(=O)O.
What is the InChIKey of 4-formyl-2,6-dimethylbenzoic acid?
The InChIKey is IZLUAIAAIWYAHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-6-3-8(5-11)4-7(2)9(6)10(12)13/h3-5H,1-2H3,(H,12,13).
What are the key properties of 4-formyl-2,6-dimethylbenzoic acid?
4-formyl-2,6-dimethylbenzoic acid has a molecular weight of 178.19 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formyl-2,6-dimethylbenzoic acid is sourced from PubChem (CID 20619423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).