C34H46N2O5S — CID 20623196
2-[[4-[[[1-(cyclohexylmethyl)cyclobutyl]-cyclopropylamino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid (PubChem CID 20623196) has the molecular formula C34H46N2O5S and a molecular weight of 594.82 g/mol. Its IUPAC name is 2-[[4-[[[1-(cyclohexylmethyl)cyclobutyl]-cyclopropylamino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[[4-[[[1-(cyclohexylmethyl)cyclobutyl]-cyclopropylamino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 20623196 |
| Molecular Formula | C34H46N2O5S |
| Molecular Weight | 594.82 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | 2-[[4-[[[1-(cyclohexylmethyl)cyclobutyl]-cyclopropylamino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid |
| SMILES | Cc1ccccc1-c1cc(CN(C2CC2)C2(CC3CCCCC3)CCC2)ccc1C(=O)NC(CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C34H46N2O5S/c1-24-9-6-7-12-28(24)30-21-26(13-16-29(30)32(37)35-31(33(38)39)17-20-42(2,40)41)23-36(27-14-15-27)34(18-8-19-34)22-25-10-4-3-5-11-25/h6-7,9,12-13,16,21,25,27,31H,3-5,8,10-11,14-15,17-20,22-23H2,1-2H3,(H,35,37)(H,38,39) |
| InChIKey | SLCIQJFSEZFQJH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.82 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |