C31H43NO7S — CID 59948759
(2S)-2-[[4-(3-cyclohexyloxy-4-ethoxybutyl)-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid (PubChem CID 59948759) has the molecular formula C31H43NO7S and a molecular weight of 573.75 g/mol. Its IUPAC name is (2S)-2-[[4-(3-cyclohexyloxy-4-ethoxybutyl)-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid.
| Compound Name | (2S)-2-[[4-(3-cyclohexyloxy-4-ethoxybutyl)-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 59948759 |
| Molecular Formula | C31H43NO7S |
| Molecular Weight | 573.75 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | (2S)-2-[[4-(3-cyclohexyloxy-4-ethoxybutyl)-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid |
| SMILES | CCOCC(CCc1ccc(C(=O)N[C@@H](CCS(C)(=O)=O)C(=O)O)c(-c2ccccc2C)c1)OC1CCCCC1 |
| InChI | InChI=1S/C31H43NO7S/c1-4-38-21-25(39-24-11-6-5-7-12-24)16-14-23-15-17-27(28(20-23)26-13-9-8-10-22(26)2)30(33)32-29(31(34)35)18-19-40(3,36)37/h8-10,13,15,17,20,24-25,29H,4-7,11-12,14,16,18-19,21H2,1-3H3,(H,32,33)(H,34,35)/t25?,29-/m0/s1 |
| InChIKey | BPWCOOHZZHIJDK-QFCCLOIZSA-N |
| XLogP | 4.97 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.75 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |