C23H38O9 — CID 20624699
methyl 3,4,5-tris(2,2-dimethylpropanoyloxy)-6-methyloxane-2-carboxylate (PubChem CID 20624699) has the molecular formula C23H38O9 and a molecular weight of 458.55 g/mol. Its IUPAC name is methyl 3,4,5-tris(2,2-dimethylpropanoyloxy)-6-methyloxane-2-carboxylate.
| Compound Name | methyl 3,4,5-tris(2,2-dimethylpropanoyloxy)-6-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 20624699 |
| Molecular Formula | C23H38O9 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | methyl 3,4,5-tris(2,2-dimethylpropanoyloxy)-6-methyloxane-2-carboxylate |
| SMILES | COC(=O)C1OC(C)C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H38O9/c1-12-13(30-18(25)21(2,3)4)14(31-19(26)22(5,6)7)15(16(29-12)17(24)28-11)32-20(27)23(8,9)10/h12-16H,1-11H3 |
| InChIKey | BSPIBSRWXMSGHA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|