C19H26O13 — CID 56639229
[(2R,3R,4S,5S)-2,3,4,5,7-pentaacetyloxy-6-oxoheptyl] acetate (PubChem CID 56639229) has the molecular formula C19H26O13 and a molecular weight of 462.40 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2,3,4,5,7-pentaacetyloxy-6-oxoheptyl] acetate.
| Compound Name | [(2R,3R,4S,5S)-2,3,4,5,7-pentaacetyloxy-6-oxoheptyl] acetate |
|---|---|
| PubChem CID | 56639229 |
| Molecular Formula | C19H26O13 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | [(2R,3R,4S,5S)-2,3,4,5,7-pentaacetyloxy-6-oxoheptyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C19H26O13/c1-9(20)27-7-15(26)17(30-12(4)23)19(32-14(6)25)18(31-13(5)24)16(29-11(3)22)8-28-10(2)21/h16-19H,7-8H2,1-6H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | XPMDRAKLEATMMH-NCXUSEDFSA-N |
| XLogP | -0.59 |
| TPSA | 174.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|