C15H8F12O11 — CID 91694794
methyl 2-oxo-3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]hexanoate (PubChem CID 91694794) has the molecular formula C15H8F12O11 and a molecular weight of 592.19 g/mol. Its IUPAC name is methyl 2-oxo-3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]hexanoate.
| Compound Name | methyl 2-oxo-3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]hexanoate |
|---|---|
| PubChem CID | 91694794 |
| Molecular Formula | C15H8F12O11 |
| Molecular Weight | 592.19 g/mol |
| Exact Mass | 591.99 |
| IUPAC Name | methyl 2-oxo-3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]hexanoate |
| SMILES | COC(=O)C(=O)C(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C(COC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H8F12O11/c1-34-7(29)4(28)6(38-11(33)15(25,26)27)5(37-10(32)14(22,23)24)3(36-9(31)13(19,20)21)2-35-8(30)12(16,17)18/h3,5-6H,2H2,1H3 |
| InChIKey | ODXLNIXRVBTRPN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|