C25H40N4O5Si — CID 20624738
tert-butyl (3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4-(5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 20624738) has the molecular formula C25H40N4O5Si and a molecular weight of 504.70 g/mol. Its IUPAC name is tert-butyl (3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4-(5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4-(5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 20624738 |
| Molecular Formula | C25H40N4O5Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | tert-butyl (3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4-(5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]2[C@@H]1c1c[nH]c2cncnc12 |
| InChI | InChI=1S/C25H40N4O5Si/c1-23(2,3)34-22(30)29-17(13-31-35(9,10)24(4,5)6)20-21(33-25(7,8)32-20)19(29)15-11-27-16-12-26-14-28-18(15)16/h11-12,14,17,19-21,27H,13H2,1-10H3/t17-,19+,20-,21+/m1/s1 |
| InChIKey | ASIYLIUTZCALCW-PMXSJFBMSA-N |
| XLogP | 5.16 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|