C44H59N4O3+ — CID 20625071
2-[N-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]anilino]ethyl-[6-[(2-methoxyphenyl)methoxy]hexyl]-dimethylazanium (PubChem CID 20625071) has the molecular formula C44H59N4O3+ and a molecular weight of 691.98 g/mol. Its IUPAC name is 2-[N-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]anilino]ethyl-[6-[(2-methoxyphenyl)methoxy]hexyl]-dimethylazanium.
| Compound Name | 2-[N-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]anilino]ethyl-[6-[(2-methoxyphenyl)methoxy]hexyl]-dimethylazanium |
|---|---|
| PubChem CID | 20625071 |
| Molecular Formula | C44H59N4O3+ |
| Molecular Weight | 691.98 g/mol |
| Exact Mass | 691.46 |
| IUPAC Name | 2-[N-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]anilino]ethyl-[6-[(2-methoxyphenyl)methoxy]hexyl]-dimethylazanium |
| SMILES | COc1ccccc1COCCCCCC[N+](C)(C)CCN(CCN1CCC(C(C(N)=O)(c2ccccc2)c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C44H58N4O3/c1-48(2,32-17-4-5-18-34-51-36-37-19-15-16-26-42(37)50-3)33-31-47(41-24-13-8-14-25-41)30-29-46-28-27-40(35-46)44(43(45)49,38-20-9-6-10-21-38)39-22-11-7-12-23-39/h6-16,19-26,40H,4-5,17-18,27-36H2,1-3H3,(H-,45,49)/p+1 |
| InChIKey | NXLHYWUKTIYNFC-UHFFFAOYSA-O |
| XLogP | 7.15 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.98 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|