C9H22N2S2 — CID 20625586
2-[2-[propan-2-yl(2-sulfanylethyl)amino]ethylamino]ethanethiol (PubChem CID 20625586) has the molecular formula C9H22N2S2 and a molecular weight of 222.42 g/mol. Its IUPAC name is 2-[2-[propan-2-yl(2-sulfanylethyl)amino]ethylamino]ethanethiol.
| Compound Name | 2-[2-[propan-2-yl(2-sulfanylethyl)amino]ethylamino]ethanethiol |
|---|---|
| PubChem CID | 20625586 |
| Molecular Formula | C9H22N2S2 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-[2-[propan-2-yl(2-sulfanylethyl)amino]ethylamino]ethanethiol |
| SMILES | CC(C)N(CCS)CCNCCS |
| InChI | InChI=1S/C9H22N2S2/c1-9(2)11(6-8-13)5-3-10-4-7-12/h9-10,12-13H,3-8H2,1-2H3 |
| InChIKey | DTVZRZQJTKPKQW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|