C22H15F2N5O — CID 20626440
N-(5,7-difluoro-1H-indazol-3-yl)-2-(2-methoxyphenyl)quinazolin-4-amine (PubChem CID 20626440) has the molecular formula C22H15F2N5O and a molecular weight of 403.39 g/mol. Its IUPAC name is N-(5,7-difluoro-1H-indazol-3-yl)-2-(2-methoxyphenyl)quinazolin-4-amine.
| Compound Name | N-(5,7-difluoro-1H-indazol-3-yl)-2-(2-methoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 20626440 |
| Molecular Formula | C22H15F2N5O |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-(5,7-difluoro-1H-indazol-3-yl)-2-(2-methoxyphenyl)quinazolin-4-amine |
| SMILES | COc1ccccc1-c1nc(Nc2n[nH]c3c(F)cc(F)cc23)c2ccccc2n1 |
| InChI | InChI=1S/C22H15F2N5O/c1-30-18-9-5-3-7-14(18)21-25-17-8-4-2-6-13(17)20(26-21)27-22-15-10-12(23)11-16(24)19(15)28-29-22/h2-11H,1H3,(H2,25,26,27,28,29) |
| InChIKey | IEPKQLKOYJBHTE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |