C19H18N4O — CID 3566059
N-(4-methoxyphenyl)-1,3-dimethylpyrazolo[3,4-b]quinolin-4-amine (PubChem CID 3566059) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,3-dimethylpyrazolo[3,4-b]quinolin-4-amine.
| Compound Name | N-(4-methoxyphenyl)-1,3-dimethylpyrazolo[3,4-b]quinolin-4-amine |
|---|---|
| PubChem CID | 3566059 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-(4-methoxyphenyl)-1,3-dimethylpyrazolo[3,4-b]quinolin-4-amine |
| SMILES | COc1ccc(Nc2c3ccccc3nc3c2c(C)nn3C)cc1 |
| InChI | InChI=1S/C19H18N4O/c1-12-17-18(20-13-8-10-14(24-3)11-9-13)15-6-4-5-7-16(15)21-19(17)23(2)22-12/h4-11H,1-3H3,(H,20,21) |
| InChIKey | CIVSXNOTCMZTDX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |