C17H28N2O4S2 — CID 20629459
4-(tert-butylsulfonylamino)-N-[2-(4-hydroxythiophen-2-yl)ethyl]cyclohexane-1-carboxamide (PubChem CID 20629459) has the molecular formula C17H28N2O4S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 4-(tert-butylsulfonylamino)-N-[2-(4-hydroxythiophen-2-yl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(tert-butylsulfonylamino)-N-[2-(4-hydroxythiophen-2-yl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20629459 |
| Molecular Formula | C17H28N2O4S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-(tert-butylsulfonylamino)-N-[2-(4-hydroxythiophen-2-yl)ethyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CCC(C(=O)NCCc2cc(O)cs2)CC1 |
| InChI | InChI=1S/C17H28N2O4S2/c1-17(2,3)25(22,23)19-13-6-4-12(5-7-13)16(21)18-9-8-15-10-14(20)11-24-15/h10-13,19-20H,4-9H2,1-3H3,(H,18,21) |
| InChIKey | NONCBJYHYBXOMO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|