C24H20F3N3O6 — CID 20632940
methyl 2-[[5-oxamoyl-1-phenyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-pyrido[4,3-b]indolizin-6-yl]oxy]acetate (PubChem CID 20632940) has the molecular formula C24H20F3N3O6 and a molecular weight of 503.43 g/mol. Its IUPAC name is methyl 2-[[5-oxamoyl-1-phenyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-pyrido[4,3-b]indolizin-6-yl]oxy]acetate.
| Compound Name | methyl 2-[[5-oxamoyl-1-phenyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-pyrido[4,3-b]indolizin-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 20632940 |
| Molecular Formula | C24H20F3N3O6 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | methyl 2-[[5-oxamoyl-1-phenyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-pyrido[4,3-b]indolizin-6-yl]oxy]acetate |
| SMILES | COC(=O)COc1cccn2c3c(c(C(=O)C(N)=O)c12)CCN(C(=O)C(F)(F)F)C3c1ccccc1 |
| InChI | InChI=1S/C24H20F3N3O6/c1-35-16(31)12-36-15-8-5-10-29-19-14(17(20(15)29)21(32)22(28)33)9-11-30(23(34)24(25,26)27)18(19)13-6-3-2-4-7-13/h2-8,10,18H,9,11-12H2,1H3,(H2,28,33) |
| InChIKey | FLJZOBJTPUQAAC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|