About 2-methyl-6,7-dihydronaphthalen-1-ol
2-methyl-6,7-dihydronaphthalen-1-ol (PubChem CID 20633888) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-methyl-6,7-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | 2-methyl-6,7-dihydronaphthalen-1-ol |
| PubChem CID | 20633888 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2-methyl-6,7-dihydronaphthalen-1-ol |
| SMILES | Cc1ccc2c(c1O)=CCCC=2 |
| InChI | InChI=1S/C11H12O/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h4-7,12H,2-3H2,1H3 |
| InChIKey | FZUBJXMNUKLYGH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-6,7-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6,7-dihydronaphthalen-1-ol?
The IUPAC name of 2-methyl-6,7-dihydronaphthalen-1-ol (CID 20633888) is 2-methyl-6,7-dihydronaphthalen-1-ol.
What is the SMILES notation for 2-methyl-6,7-dihydronaphthalen-1-ol?
The canonical SMILES for 2-methyl-6,7-dihydronaphthalen-1-ol is Cc1ccc2c(c1O)=CCCC=2.
What is the InChIKey of 2-methyl-6,7-dihydronaphthalen-1-ol?
The InChIKey is FZUBJXMNUKLYGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h4-7,12H,2-3H2,1H3.
What are the key properties of 2-methyl-6,7-dihydronaphthalen-1-ol?
2-methyl-6,7-dihydronaphthalen-1-ol has a molecular weight of 160.22 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,7-dihydronaphthalen-1-ol is sourced from PubChem (CID 20633888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).