C36H43N3O9S2 — CID 20636890
3-[[4-[[[4-butoxy-2,3-bis(methylsulfonyl)phenyl]carbamoylamino]-[4-(cyclohexen-1-yl)phenyl]methyl]benzoyl]amino]propanoic acid (PubChem CID 20636890) has the molecular formula C36H43N3O9S2 and a molecular weight of 725.89 g/mol. Its IUPAC name is 3-[[4-[[[4-butoxy-2,3-bis(methylsulfonyl)phenyl]carbamoylamino]-[4-(cyclohexen-1-yl)phenyl]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[[4-butoxy-2,3-bis(methylsulfonyl)phenyl]carbamoylamino]-[4-(cyclohexen-1-yl)phenyl]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20636890 |
| Molecular Formula | C36H43N3O9S2 |
| Molecular Weight | 725.89 g/mol |
| Exact Mass | 725.24 |
| IUPAC Name | 3-[[4-[[[4-butoxy-2,3-bis(methylsulfonyl)phenyl]carbamoylamino]-[4-(cyclohexen-1-yl)phenyl]methyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCOc1ccc(NC(=O)NC(c2ccc(C(=O)NCCC(=O)O)cc2)c2ccc(C3=CCCCC3)cc2)c(S(C)(=O)=O)c1S(C)(=O)=O |
| InChI | InChI=1S/C36H43N3O9S2/c1-4-5-23-48-30-20-19-29(33(49(2,44)45)34(30)50(3,46)47)38-36(43)39-32(26-13-11-25(12-14-26)24-9-7-6-8-10-24)27-15-17-28(18-16-27)35(42)37-22-21-31(40)41/h9,11-20,32H,4-8,10,21-23H2,1-3H3,(H,37,42)(H,40,41)(H2,38,39,43) |
| InChIKey | SGRHMXURFMZKSF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 185.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.89 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|