C5H13NO3P- — CID 2063729
[(1R)-2,2-dimethyl-1-phosphonatopropyl]azanium (PubChem CID 2063729) has the molecular formula C5H13NO3P- and a molecular weight of 166.14 g/mol. Its IUPAC name is [(1R)-2,2-dimethyl-1-phosphonatopropyl]azanium.
| Compound Name | [(1R)-2,2-dimethyl-1-phosphonatopropyl]azanium |
|---|---|
| PubChem CID | 2063729 |
| Molecular Formula | C5H13NO3P- |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | [(1R)-2,2-dimethyl-1-phosphonatopropyl]azanium |
| SMILES | CC(C)(C)[C@H]([NH3+])P(=O)([O-])[O-] |
| InChI | InChI=1S/C5H14NO3P/c1-5(2,3)4(6)10(7,8)9/h4H,6H2,1-3H3,(H2,7,8,9)/p-1/t4-/m1/s1 |
| InChIKey | OZTDKZBAEQVCEE-SCSAIBSYSA-M |
| XLogP | -1.49 |
| TPSA | 90.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|