C32H30N4O — CID 20640956
4-methyl-N-[(E)-[2-[(E)-C-methyl-N-(N-methylanilino)carbonimidoyl]-1-benzofuran-5-yl]methylideneamino]-N-(4-methylphenyl)aniline (PubChem CID 20640956) has the molecular formula C32H30N4O and a molecular weight of 486.62 g/mol. Its IUPAC name is 4-methyl-N-[(E)-[2-[(E)-C-methyl-N-(N-methylanilino)carbonimidoyl]-1-benzofuran-5-yl]methylideneamino]-N-(4-methylphenyl)aniline.
| Compound Name | 4-methyl-N-[(E)-[2-[(E)-C-methyl-N-(N-methylanilino)carbonimidoyl]-1-benzofuran-5-yl]methylideneamino]-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 20640956 |
| Molecular Formula | C32H30N4O |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 4-methyl-N-[(E)-[2-[(E)-C-methyl-N-(N-methylanilino)carbonimidoyl]-1-benzofuran-5-yl]methylideneamino]-N-(4-methylphenyl)aniline |
| SMILES | C/C(=N\N(C)c1ccccc1)c1cc2cc(/C=N/N(c3ccc(C)cc3)c3ccc(C)cc3)ccc2o1 |
| InChI | InChI=1S/C32H30N4O/c1-23-10-15-29(16-11-23)36(30-17-12-24(2)13-18-30)33-22-26-14-19-31-27(20-26)21-32(37-31)25(3)34-35(4)28-8-6-5-7-9-28/h5-22H,1-4H3/b33-22+,34-25+ |
| InChIKey | YDXRBALRXPZJPY-ICXYAEKKSA-N |
| XLogP | 8.08 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|