C12H24N2O — CID 20644911
N,N,4-triethylpiperidine-1-carboxamide (PubChem CID 20644911) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is N,N,4-triethylpiperidine-1-carboxamide.
| Compound Name | N,N,4-triethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 20644911 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | N,N,4-triethylpiperidine-1-carboxamide |
| SMILES | CCC1CCN(C(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C12H24N2O/c1-4-11-7-9-14(10-8-11)12(15)13(5-2)6-3/h11H,4-10H2,1-3H3 |
| InChIKey | WECSIUQBRHNPJL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |