C33H42Cl2N6O6 — CID 20648082
(2,4,6-trimethylcyclohexyl) 5-[bis(chloromethyl)carbamoyloxy]-2-[2-(2,4-dimethylphenoxy)hexanoylamino]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20648082) has the molecular formula C33H42Cl2N6O6 and a molecular weight of 689.64 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 5-[bis(chloromethyl)carbamoyloxy]-2-[2-(2,4-dimethylphenoxy)hexanoylamino]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 5-[bis(chloromethyl)carbamoyloxy]-2-[2-(2,4-dimethylphenoxy)hexanoylamino]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20648082 |
| Molecular Formula | C33H42Cl2N6O6 |
| Molecular Weight | 689.64 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 5-[bis(chloromethyl)carbamoyloxy]-2-[2-(2,4-dimethylphenoxy)hexanoylamino]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(NC(=O)C(CCCC)Oc3ccc(C)cc3C)[nH]n2c1OC(=O)N(CCl)CCl |
| InChI | InChI=1S/C33H42Cl2N6O6/c1-8-9-10-24(45-23-12-11-18(2)13-20(23)4)29(42)38-32-37-28-25(31(43)46-27-21(5)14-19(3)15-22(27)6)26(36-7)30(41(28)39-32)47-33(44)40(16-34)17-35/h11-13,19,21-22,24,27H,8-10,14-17H2,1-6H3,(H2,37,38,39,42) |
| InChIKey | XKKWBBMKGWVEQT-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.64 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|