C29H35ClN4O4 — CID 18339594
(2,4,6-trimethylcyclohexyl) 5-(2-chlorobenzoyl)oxy-6-isocyano-2-(3-methylpentan-3-yl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 18339594) has the molecular formula C29H35ClN4O4 and a molecular weight of 539.08 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 5-(2-chlorobenzoyl)oxy-6-isocyano-2-(3-methylpentan-3-yl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 5-(2-chlorobenzoyl)oxy-6-isocyano-2-(3-methylpentan-3-yl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 18339594 |
| Molecular Formula | C29H35ClN4O4 |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 5-(2-chlorobenzoyl)oxy-6-isocyano-2-(3-methylpentan-3-yl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(C(C)(CC)CC)[nH]n2c1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C29H35ClN4O4/c1-8-29(6,9-2)28-32-24-21(27(36)37-23-17(4)14-16(3)15-18(23)5)22(31-7)25(34(24)33-28)38-26(35)19-12-10-11-13-20(19)30/h10-13,16-18,23H,8-9,14-15H2,1-6H3,(H,32,33) |
| InChIKey | NOBKAFNGEVFGSL-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|