C22H28N2O3S — CID 20649322
N-(2,3-dihydro-1H-inden-1-yl)-2-methyl-5-(3-methylbutylsulfamoyl)benzamide (PubChem CID 20649322) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-2-methyl-5-(3-methylbutylsulfamoyl)benzamide.
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-2-methyl-5-(3-methylbutylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 20649322 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-2-methyl-5-(3-methylbutylsulfamoyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(C)C)cc1C(=O)NC1CCc2ccccc21 |
| InChI | InChI=1S/C22H28N2O3S/c1-15(2)12-13-23-28(26,27)18-10-8-16(3)20(14-18)22(25)24-21-11-9-17-6-4-5-7-19(17)21/h4-8,10,14-15,21,23H,9,11-13H2,1-3H3,(H,24,25) |
| InChIKey | QXQIWDBYYDCWAH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |