C21H23Cl2N3O5S — CID 20649235
2,4-dichloro-N-(2,3-dihydro-1H-inden-1-yl)-5-(3-methylbutylsulfamoyl)-3-nitrobenzamide (PubChem CID 20649235) has the molecular formula C21H23Cl2N3O5S and a molecular weight of 500.40 g/mol. Its IUPAC name is 2,4-dichloro-N-(2,3-dihydro-1H-inden-1-yl)-5-(3-methylbutylsulfamoyl)-3-nitrobenzamide.
| Compound Name | 2,4-dichloro-N-(2,3-dihydro-1H-inden-1-yl)-5-(3-methylbutylsulfamoyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 20649235 |
| Molecular Formula | C21H23Cl2N3O5S |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | 2,4-dichloro-N-(2,3-dihydro-1H-inden-1-yl)-5-(3-methylbutylsulfamoyl)-3-nitrobenzamide |
| SMILES | CC(C)CCNS(=O)(=O)c1cc(C(=O)NC2CCc3ccccc32)c(Cl)c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C21H23Cl2N3O5S/c1-12(2)9-10-24-32(30,31)17-11-15(18(22)20(19(17)23)26(28)29)21(27)25-16-8-7-13-5-3-4-6-14(13)16/h3-6,11-12,16,24H,7-10H2,1-2H3,(H,25,27) |
| InChIKey | QESBMKPZLATWBT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|