C18H19Cl2NO5 — CID 20652293
methyl 1-[(3,4-dichlorophenyl)carbamoyloxy]-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 20652293) has the molecular formula C18H19Cl2NO5 and a molecular weight of 400.26 g/mol. Its IUPAC name is methyl 1-[(3,4-dichlorophenyl)carbamoyloxy]-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl 1-[(3,4-dichlorophenyl)carbamoyloxy]-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 20652293 |
| Molecular Formula | C18H19Cl2NO5 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | methyl 1-[(3,4-dichlorophenyl)carbamoyloxy]-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=COC(OC(=O)Nc2ccc(Cl)c(Cl)c2)C2C(C)CCC12 |
| InChI | InChI=1S/C18H19Cl2NO5/c1-9-3-5-11-12(16(22)24-2)8-25-17(15(9)11)26-18(23)21-10-4-6-13(19)14(20)7-10/h4,6-9,11,15,17H,3,5H2,1-2H3,(H,21,23) |
| InChIKey | WXVABPIMXOOVJY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |