C16H28O4Si — CID 174086192
1-[tert-butyl(dimethyl)silyl]oxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid (PubChem CID 174086192) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
|---|---|
| PubChem CID | 174086192 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
| SMILES | CC1CCC2C(C(=O)O)=COC(O[Si](C)(C)C(C)(C)C)C12 |
| InChI | InChI=1S/C16H28O4Si/c1-10-7-8-11-12(14(17)18)9-19-15(13(10)11)20-21(5,6)16(2,3)4/h9-11,13,15H,7-8H2,1-6H3,(H,17,18) |
| InChIKey | UZVSFWSBHYAPDL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|