C31H28N4OS3 — CID 2065257
2-[[(10S,12S)-3-amino-10,12-diphenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-N-(2-phenylethyl)acetamide (PubChem CID 2065257) has the molecular formula C31H28N4OS3 and a molecular weight of 568.79 g/mol. Its IUPAC name is 2-[[(10S,12S)-3-amino-10,12-diphenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[(10S,12S)-3-amino-10,12-diphenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 2065257 |
| Molecular Formula | C31H28N4OS3 |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 2-[[(10S,12S)-3-amino-10,12-diphenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-N-(2-phenylethyl)acetamide |
| SMILES | Nc1nc(SCC(=O)NCCc2ccccc2)nc2sc3c(c12)C[C@@H](c1ccccc1)S[C@H]3c1ccccc1 |
| InChI | InChI=1S/C31H28N4OS3/c32-29-26-23-18-24(21-12-6-2-7-13-21)38-27(22-14-8-3-9-15-22)28(23)39-30(26)35-31(34-29)37-19-25(36)33-17-16-20-10-4-1-5-11-20/h1-15,24,27H,16-19H2,(H,33,36)(H2,32,34,35)/t24-,27-/m0/s1 |
| InChIKey | NOWZRNNTGPNKSK-IGKIAQTJSA-N |
| XLogP | 6.84 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |