C29H23ClN4OS3 — CID 4918323
2-[(3-amino-10,12-diphenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-N-(4-chlorophenyl)acetamide (PubChem CID 4918323) has the molecular formula C29H23ClN4OS3 and a molecular weight of 575.18 g/mol. Its IUPAC name is 2-[(3-amino-10,12-diphenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[(3-amino-10,12-diphenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4918323 |
| Molecular Formula | C29H23ClN4OS3 |
| Molecular Weight | 575.18 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | 2-[(3-amino-10,12-diphenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-N-(4-chlorophenyl)acetamide |
| SMILES | Nc1nc(SCC(=O)Nc2ccc(Cl)cc2)nc2sc3c(c12)CC(c1ccccc1)SC3c1ccccc1 |
| InChI | InChI=1S/C29H23ClN4OS3/c30-19-11-13-20(14-12-19)32-23(35)16-36-29-33-27(31)24-21-15-22(17-7-3-1-4-8-17)37-25(18-9-5-2-6-10-18)26(21)38-28(24)34-29/h1-14,22,25H,15-16H2,(H,32,35)(H2,31,33,34) |
| InChIKey | OMDDGKKXVJVMRU-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.18 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |