C21H24N4O2S2 — CID 4640892
2-[(3-amino-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-N-benzylacetamide (PubChem CID 4640892) has the molecular formula C21H24N4O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[(3-amino-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-N-benzylacetamide.
| Compound Name | 2-[(3-amino-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-N-benzylacetamide |
|---|---|
| PubChem CID | 4640892 |
| Molecular Formula | C21H24N4O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[(3-amino-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-N-benzylacetamide |
| SMILES | CCC1(C)Cc2c(sc3nc(SCC(=O)NCc4ccccc4)nc(N)c23)CO1 |
| InChI | InChI=1S/C21H24N4O2S2/c1-3-21(2)9-14-15(11-27-21)29-19-17(14)18(22)24-20(25-19)28-12-16(26)23-10-13-7-5-4-6-8-13/h4-8H,3,9-12H2,1-2H3,(H,23,26)(H2,22,24,25) |
| InChIKey | DXZYZWJFTNHRSN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |